About [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate
[(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate (PubChem CID 141432375) has the molecular formula C12H16FNO3S
and a molecular weight of 273.33 g/mol. Its IUPAC name is [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate.
Molecular Properties
| Compound Name | [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate |
| PubChem CID | 141432375 |
| Molecular Formula | C12H16FNO3S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate |
| SMILES | O=S(=O)(Cc1ccccc1)O[C@@H]1CCNC[C@@H]1F |
| InChI | InChI=1S/C12H16FNO3S/c13-11-8-14-7-6-12(11)17-18(15,16)9-10-4-2-1-3-5-10/h1-5,11-12,14H,6-9H2/t11-,12+/m0/s1 |
| InChIKey | LNUHKTPSCPBPPS-NWDGAFQWSA-N |
| XLogP | 1.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate?
The IUPAC name of [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate (CID 141432375) is [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate.
What is the SMILES notation for [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate?
The canonical SMILES for [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate is O=S(=O)(Cc1ccccc1)O[C@@H]1CCNC[C@@H]1F.
What is the InChIKey of [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate?
The InChIKey is LNUHKTPSCPBPPS-NWDGAFQWSA-N. The full InChI is InChI=1S/C12H16FNO3S/c13-11-8-14-7-6-12(11)17-18(15,16)9-10-4-2-1-3-5-10/h1-5,11-12,14H,6-9H2/t11-,12+/m0/s1.
What are the key properties of [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate?
[(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate has a molecular weight of 273.33 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-3-fluoropiperidin-4-yl] phenylmethanesulfonate is sourced from PubChem (CID 141432375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).