About 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide
2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide (PubChem CID 141432579) has the molecular formula C24H22N2O
and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide |
| PubChem CID | 141432579 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)C#Cc1ccc(-c2ccccc2-c2ncccc2C(N)=O)cc1 |
| InChI | InChI=1S/C24H22N2O/c1-24(2,3)15-14-17-10-12-18(13-11-17)19-7-4-5-8-20(19)22-21(23(25)27)9-6-16-26-22/h4-13,16H,1-3H3,(H2,25,27) |
| InChIKey | ZSGSCDMUMQXRGY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide?
The IUPAC name of 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide (CID 141432579) is 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide.
What is the SMILES notation for 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide?
The canonical SMILES for 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide is CC(C)(C)C#Cc1ccc(-c2ccccc2-c2ncccc2C(N)=O)cc1.
What is the InChIKey of 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide?
The InChIKey is ZSGSCDMUMQXRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O/c1-24(2,3)15-14-17-10-12-18(13-11-17)19-7-4-5-8-20(19)22-21(23(25)27)9-6-16-26-22/h4-13,16H,1-3H3,(H2,25,27).
What are the key properties of 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide?
2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide has a molecular weight of 354.45 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(3,3-dimethylbut-1-ynyl)phenyl]phenyl]pyridine-3-carboxamide is sourced from PubChem (CID 141432579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).