About 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid
4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (PubChem CID 141433111) has the molecular formula C7H6O5
and a molecular weight of 170.12 g/mol. Its IUPAC name is 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| PubChem CID | 141433111 |
| Molecular Formula | C7H6O5 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C12C=CC(O)=C(O)C1O2 |
| InChI | InChI=1S/C7H6O5/c8-3-1-2-7(6(10)11)5(12-7)4(3)9/h1-2,5,8-9H,(H,10,11) |
| InChIKey | YRALLGSXUYMGPZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid?
The IUPAC name of 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid (CID 141433111) is 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid is O=C(O)C12C=CC(O)=C(O)C1O2.
What is the InChIKey of 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid?
The InChIKey is YRALLGSXUYMGPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5/c8-3-1-2-7(6(10)11)5(12-7)4(3)9/h1-2,5,8-9H,(H,10,11).
What are the key properties of 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid?
4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid has a molecular weight of 170.12 g/mol, XLogP of 0.11, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-7-oxabicyclo[4.1.0]hepta-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 141433111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).