C19H34FN3O2Si — CID 141433641
[(1R,2R,3R,4R)-3-fluoro-4-(pyrimidin-4-ylamino)-2-tri(propan-2-yl)silyloxycyclopentyl]methanol (PubChem CID 141433641) has the molecular formula C19H34FN3O2Si and a molecular weight of 383.58 g/mol. Its IUPAC name is [(1R,2R,3R,4R)-3-fluoro-4-(pyrimidin-4-ylamino)-2-tri(propan-2-yl)silyloxycyclopentyl]methanol.
| Compound Name | [(1R,2R,3R,4R)-3-fluoro-4-(pyrimidin-4-ylamino)-2-tri(propan-2-yl)silyloxycyclopentyl]methanol |
|---|---|
| PubChem CID | 141433641 |
| Molecular Formula | C19H34FN3O2Si |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | [(1R,2R,3R,4R)-3-fluoro-4-(pyrimidin-4-ylamino)-2-tri(propan-2-yl)silyloxycyclopentyl]methanol |
| SMILES | CC(C)[Si](O[C@@H]1[C@@H](CO)C[C@@H](Nc2ccncn2)[C@H]1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H34FN3O2Si/c1-12(2)26(13(3)4,14(5)6)25-19-15(10-24)9-16(18(19)20)23-17-7-8-21-11-22-17/h7-8,11-16,18-19,24H,9-10H2,1-6H3,(H,21,22,23)/t15-,16-,18-,19-/m1/s1 |
| InChIKey | DQPKNJOFTMZAET-PSBWJHGTSA-N |
| XLogP | 4.17 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|