About (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene
(2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene (PubChem CID 141433831) has the molecular formula C22H19FO2
and a molecular weight of 334.39 g/mol. Its IUPAC name is (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene |
| PubChem CID | 141433831 |
| Molecular Formula | C22H19FO2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene |
| SMILES | COc1ccc(F)c(-c2ccc([C@@H]3CCc4ccccc4O3)cc2)c1 |
| InChI | InChI=1S/C22H19FO2/c1-24-18-11-12-20(23)19(14-18)15-6-8-17(9-7-15)22-13-10-16-4-2-3-5-21(16)25-22/h2-9,11-12,14,22H,10,13H2,1H3/t22-/m0/s1 |
| InChIKey | WCESAKNLHVRYRP-QFIPXVFZSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene?
The IUPAC name of (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene (CID 141433831) is (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene.
What is the SMILES notation for (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene?
The canonical SMILES for (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene is COc1ccc(F)c(-c2ccc([C@@H]3CCc4ccccc4O3)cc2)c1.
What is the InChIKey of (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene?
The InChIKey is WCESAKNLHVRYRP-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H19FO2/c1-24-18-11-12-20(23)19(14-18)15-6-8-17(9-7-15)22-13-10-16-4-2-3-5-21(16)25-22/h2-9,11-12,14,22H,10,13H2,1H3/t22-/m0/s1.
What are the key properties of (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene?
(2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene has a molecular weight of 334.39 g/mol, XLogP of 5.57, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[4-(2-fluoro-5-methoxyphenyl)phenyl]-3,4-dihydro-2H-chromene is sourced from PubChem (CID 141433831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).