About 1-ethyl-5-methyl-3,4-diphenylimidazolidine
1-ethyl-5-methyl-3,4-diphenylimidazolidine (PubChem CID 14143406) has the molecular formula C18H22N2
and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-ethyl-5-methyl-3,4-diphenylimidazolidine.
Molecular Properties
| Compound Name | 1-ethyl-5-methyl-3,4-diphenylimidazolidine |
| PubChem CID | 14143406 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-ethyl-5-methyl-3,4-diphenylimidazolidine |
| SMILES | CCN1CN(c2ccccc2)C(c2ccccc2)C1C |
| InChI | InChI=1S/C18H22N2/c1-3-19-14-20(17-12-8-5-9-13-17)18(15(19)2)16-10-6-4-7-11-16/h4-13,15,18H,3,14H2,1-2H3 |
| InChIKey | VXZGNBIKEBXDOC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-5-methyl-3,4-diphenylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-methyl-3,4-diphenylimidazolidine?
The IUPAC name of 1-ethyl-5-methyl-3,4-diphenylimidazolidine (CID 14143406) is 1-ethyl-5-methyl-3,4-diphenylimidazolidine.
What is the SMILES notation for 1-ethyl-5-methyl-3,4-diphenylimidazolidine?
The canonical SMILES for 1-ethyl-5-methyl-3,4-diphenylimidazolidine is CCN1CN(c2ccccc2)C(c2ccccc2)C1C.
What is the InChIKey of 1-ethyl-5-methyl-3,4-diphenylimidazolidine?
The InChIKey is VXZGNBIKEBXDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2/c1-3-19-14-20(17-12-8-5-9-13-17)18(15(19)2)16-10-6-4-7-11-16/h4-13,15,18H,3,14H2,1-2H3.
What are the key properties of 1-ethyl-5-methyl-3,4-diphenylimidazolidine?
1-ethyl-5-methyl-3,4-diphenylimidazolidine has a molecular weight of 266.39 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-methyl-3,4-diphenylimidazolidine is sourced from PubChem (CID 14143406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).