C20H15BrFNO8S — CID 141434088
3-(4-bromophenyl)-5-fluoro-1-(4-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylic acid (PubChem CID 141434088) has the molecular formula C20H15BrFNO8S and a molecular weight of 528.31 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-fluoro-1-(4-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylic acid.
| Compound Name | 3-(4-bromophenyl)-5-fluoro-1-(4-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 141434088 |
| Molecular Formula | C20H15BrFNO8S |
| Molecular Weight | 528.31 g/mol |
| Exact Mass | 526.97 |
| IUPAC Name | 3-(4-bromophenyl)-5-fluoro-1-(4-methylphenyl)sulfonyl-3H-pyrrole-2,2,4-tricarboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2C(F)=C(C(=O)O)C(c3ccc(Br)cc3)C2(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H15BrFNO8S/c1-10-2-8-13(9-3-10)32(30,31)23-16(22)14(17(24)25)15(11-4-6-12(21)7-5-11)20(23,18(26)27)19(28)29/h2-9,15H,1H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | BOKXEELFCWGTDP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|