C15H13F4N5 — CID 141434378
6-N-(4-fluorophenyl)-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine (PubChem CID 141434378) has the molecular formula C15H13F4N5 and a molecular weight of 339.30 g/mol. Its IUPAC name is 6-N-(4-fluorophenyl)-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine.
| Compound Name | 6-N-(4-fluorophenyl)-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine |
|---|---|
| PubChem CID | 141434378 |
| Molecular Formula | C15H13F4N5 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6-N-(4-fluorophenyl)-8-N-(3,3,3-trifluoropropyl)imidazo[1,2-b]pyridazine-6,8-diamine |
| SMILES | Fc1ccc(Nc2cc(NCCC(F)(F)F)c3nccn3n2)cc1 |
| InChI | InChI=1S/C15H13F4N5/c16-10-1-3-11(4-2-10)22-13-9-12(20-6-5-15(17,18)19)14-21-7-8-24(14)23-13/h1-4,7-9,20H,5-6H2,(H,22,23) |
| InChIKey | MPZKDMYDIOFCKV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|