C12H11ClN2O2 — CID 141434391
1-[2-chloro-4-(1,3-dioxolan-2-yl)phenyl]imidazole (PubChem CID 141434391) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is 1-[2-chloro-4-(1,3-dioxolan-2-yl)phenyl]imidazole.
| Compound Name | 1-[2-chloro-4-(1,3-dioxolan-2-yl)phenyl]imidazole |
|---|---|
| PubChem CID | 141434391 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1-[2-chloro-4-(1,3-dioxolan-2-yl)phenyl]imidazole |
| SMILES | Clc1cc(C2OCCO2)ccc1-n1ccnc1 |
| InChI | InChI=1S/C12H11ClN2O2/c13-10-7-9(12-16-5-6-17-12)1-2-11(10)15-4-3-14-8-15/h1-4,7-8,12H,5-6H2 |
| InChIKey | QJIIWLFEAOMFMK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |