C17H26F3N5O2 — CID 141434613
tert-butyl N-methyl-N-[1-[(1S)-2,2,2-trifluoro-1-(6-hydrazinyl-3-pyridinyl)ethyl]pyrrolidin-3-yl]carbamate (PubChem CID 141434613) has the molecular formula C17H26F3N5O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-[(1S)-2,2,2-trifluoro-1-(6-hydrazinyl-3-pyridinyl)ethyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-[(1S)-2,2,2-trifluoro-1-(6-hydrazinyl-3-pyridinyl)ethyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 141434613 |
| Molecular Formula | C17H26F3N5O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl N-methyl-N-[1-[(1S)-2,2,2-trifluoro-1-(6-hydrazinyl-3-pyridinyl)ethyl]pyrrolidin-3-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN([C@@H](c2ccc(NN)nc2)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H26F3N5O2/c1-16(2,3)27-15(26)24(4)12-7-8-25(10-12)14(17(18,19)20)11-5-6-13(23-21)22-9-11/h5-6,9,12,14H,7-8,10,21H2,1-4H3,(H,22,23)/t12?,14-/m0/s1 |
| InChIKey | WVVHNKQKKHVLNO-PYMCNQPYSA-N |
| XLogP | 2.91 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|