C23H32F3N3O2 — CID 141435284
2-[[2-(difluoromethyl)-4-piperidin-1-ylphenyl]methyl]-4-(1-fluoropropan-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 141435284) has the molecular formula C23H32F3N3O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[[2-(difluoromethyl)-4-piperidin-1-ylphenyl]methyl]-4-(1-fluoropropan-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | 2-[[2-(difluoromethyl)-4-piperidin-1-ylphenyl]methyl]-4-(1-fluoropropan-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 141435284 |
| Molecular Formula | C23H32F3N3O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 2-[[2-(difluoromethyl)-4-piperidin-1-ylphenyl]methyl]-4-(1-fluoropropan-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | CC(CF)C1C2CN(Cc3ccc(N4CCCCC4)cc3C(F)F)CC2CN1C(=O)O |
| InChI | InChI=1S/C23H32F3N3O2/c1-15(10-24)21-20-14-27(12-17(20)13-29(21)23(30)31)11-16-5-6-18(9-19(16)22(25)26)28-7-3-2-4-8-28/h5-6,9,15,17,20-22H,2-4,7-8,10-14H2,1H3,(H,30,31) |
| InChIKey | BYMKVPLKTATBFG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|