About [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid
[(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid (PubChem CID 141435378) has the molecular formula C16H18BrN3O4
and a molecular weight of 396.24 g/mol. Its IUPAC name is [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid |
| PubChem CID | 141435378 |
| Molecular Formula | C16H18BrN3O4 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid |
| SMILES | CC(C)C[C@@H](NC(=O)O)C(=O)Nc1ccc(-c2cnco2)c(Br)c1 |
| InChI | InChI=1S/C16H18BrN3O4/c1-9(2)5-13(20-16(22)23)15(21)19-10-3-4-11(12(17)6-10)14-7-18-8-24-14/h3-4,6-9,13,20H,5H2,1-2H3,(H,19,21)(H,22,23)/t13-/m1/s1 |
| InChIKey | GSPNHLNHXAUDQQ-CYBMUJFWSA-N |
| XLogP | 3.72 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid?
The IUPAC name of [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid (CID 141435378) is [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid.
What is the SMILES notation for [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid?
The canonical SMILES for [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid is CC(C)C[C@@H](NC(=O)O)C(=O)Nc1ccc(-c2cnco2)c(Br)c1.
What is the InChIKey of [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid?
The InChIKey is GSPNHLNHXAUDQQ-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H18BrN3O4/c1-9(2)5-13(20-16(22)23)15(21)19-10-3-4-11(12(17)6-10)14-7-18-8-24-14/h3-4,6-9,13,20H,5H2,1-2H3,(H,19,21)(H,22,23)/t13-/m1/s1.
What are the key properties of [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid?
[(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid has a molecular weight of 396.24 g/mol, XLogP of 3.72, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-[3-bromo-4-(1,3-oxazol-5-yl)anilino]-4-methyl-1-oxopentan-2-yl]carbamic acid is sourced from PubChem (CID 141435378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).