C10H8F10O — CID 141435543
1,1,5,5,5-pentafluoro-4-(1,1,1,5,5-pentafluoropent-3-en-2-yloxy)pent-2-ene (PubChem CID 141435543) has the molecular formula C10H8F10O and a molecular weight of 334.15 g/mol. Its IUPAC name is 1,1,5,5,5-pentafluoro-4-(1,1,1,5,5-pentafluoropent-3-en-2-yloxy)pent-2-ene.
| Compound Name | 1,1,5,5,5-pentafluoro-4-(1,1,1,5,5-pentafluoropent-3-en-2-yloxy)pent-2-ene |
|---|---|
| PubChem CID | 141435543 |
| Molecular Formula | C10H8F10O |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1,1,5,5,5-pentafluoro-4-(1,1,1,5,5-pentafluoropent-3-en-2-yloxy)pent-2-ene |
| SMILES | FC(F)C=CC(OC(C=CC(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F10O/c11-7(12)3-1-5(9(15,16)17)21-6(10(18,19)20)2-4-8(13)14/h1-8H |
| InChIKey | FGVYBWXQPMKWDS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|