About 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile
5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile (PubChem CID 141436611) has the molecular formula C15H7F3N2O2
and a molecular weight of 304.23 g/mol. Its IUPAC name is 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile |
| PubChem CID | 141436611 |
| Molecular Formula | C15H7F3N2O2 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(Oc2cccc3c2[C@@H](F)C(F)(F)C3=O)c1 |
| InChI | InChI=1S/C15H7F3N2O2/c16-13-12-10(14(21)15(13,17)18)2-1-3-11(12)22-9-4-8(5-19)6-20-7-9/h1-4,6-7,13H/t13-/m1/s1 |
| InChIKey | GCFMXOHAYRVENS-CYBMUJFWSA-N |
| XLogP | 3.59 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile?
The IUPAC name of 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile (CID 141436611) is 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile.
What is the SMILES notation for 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile?
The canonical SMILES for 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile is N#Cc1cncc(Oc2cccc3c2[C@@H](F)C(F)(F)C3=O)c1.
What is the InChIKey of 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile?
The InChIKey is GCFMXOHAYRVENS-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H7F3N2O2/c16-13-12-10(14(21)15(13,17)18)2-1-3-11(12)22-9-4-8(5-19)6-20-7-9/h1-4,6-7,13H/t13-/m1/s1.
What are the key properties of 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile?
5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile has a molecular weight of 304.23 g/mol, XLogP of 3.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(3R)-2,2,3-trifluoro-1-oxo-3H-inden-4-yl]oxy]pyridine-3-carbonitrile is sourced from PubChem (CID 141436611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).