About 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine
2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine (PubChem CID 1414369) has the molecular formula C24H19NO5
and a molecular weight of 401.42 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine |
| PubChem CID | 1414369 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine |
| SMILES | COc1cc(/N=c2\cc(-c3ccc4c(c3)OCO4)oc3ccccc23)cc(OC)c1 |
| InChI | InChI=1S/C24H19NO5/c1-26-17-10-16(11-18(12-17)27-2)25-20-13-23(30-21-6-4-3-5-19(20)21)15-7-8-22-24(9-15)29-14-28-22/h3-13H,14H2,1-2H3/b25-20+ |
| InChIKey | PKPWFKWZZAFEJN-LKUDQCMESA-N |
| XLogP | 5.08 |
| TPSA | 62.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine (CID 1414369) is 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine is COc1cc(/N=c2\cc(-c3ccc4c(c3)OCO4)oc3ccccc23)cc(OC)c1.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine?
The InChIKey is PKPWFKWZZAFEJN-LKUDQCMESA-N. The full InChI is InChI=1S/C24H19NO5/c1-26-17-10-16(11-18(12-17)27-2)25-20-13-23(30-21-6-4-3-5-19(20)21)15-7-8-22-24(9-15)29-14-28-22/h3-13H,14H2,1-2H3/b25-20+.
What are the key properties of 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine?
2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine has a molecular weight of 401.42 g/mol, XLogP of 5.08, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-N-(3,5-dimethoxyphenyl)chromen-4-imine is sourced from PubChem (CID 1414369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).