About 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate
2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate (PubChem CID 141437084) has the molecular formula C15H24O6
and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate |
| PubChem CID | 141437084 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate |
| SMILES | CC(=CC(=O)OCCOCCO)C(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C15H24O6/c1-11(6-15(17)19-5-4-18-3-2-16)12(7-13-9-20-13)8-14-10-21-14/h6,12-14,16H,2-5,7-10H2,1H3 |
| InChIKey | CGPCNKNKPFYZOS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate?
The IUPAC name of 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate (CID 141437084) is 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate?
The canonical SMILES for 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate is CC(=CC(=O)OCCOCCO)C(CC1CO1)CC1CO1.
What is the InChIKey of 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate?
The InChIKey is CGPCNKNKPFYZOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O6/c1-11(6-15(17)19-5-4-18-3-2-16)12(7-13-9-20-13)8-14-10-21-14/h6,12-14,16H,2-5,7-10H2,1H3.
What are the key properties of 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate?
2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate has a molecular weight of 300.35 g/mol, XLogP of 0.68, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethyl 3-methyl-5-(oxiran-2-yl)-4-(oxiran-2-ylmethyl)pent-2-enoate is sourced from PubChem (CID 141437084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).