C17H15N5S — CID 141437181
3-N-(4-imidazo[1,2-a]pyridin-3-yl-1,3-thiazol-2-yl)-4-methylbenzene-1,3-diamine (PubChem CID 141437181) has the molecular formula C17H15N5S and a molecular weight of 321.41 g/mol. Its IUPAC name is 3-N-(4-imidazo[1,2-a]pyridin-3-yl-1,3-thiazol-2-yl)-4-methylbenzene-1,3-diamine.
| Compound Name | 3-N-(4-imidazo[1,2-a]pyridin-3-yl-1,3-thiazol-2-yl)-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 141437181 |
| Molecular Formula | C17H15N5S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 3-N-(4-imidazo[1,2-a]pyridin-3-yl-1,3-thiazol-2-yl)-4-methylbenzene-1,3-diamine |
| SMILES | Cc1ccc(N)cc1Nc1nc(-c2cnc3ccccn23)cs1 |
| InChI | InChI=1S/C17H15N5S/c1-11-5-6-12(18)8-13(11)20-17-21-14(10-23-17)15-9-19-16-4-2-3-7-22(15)16/h2-10H,18H2,1H3,(H,20,21) |
| InChIKey | QHDKSBFSSYEBLC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|