About 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate
3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate (PubChem CID 141437228) has the molecular formula C18H24O6
and a molecular weight of 336.38 g/mol. Its IUPAC name is 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate.
Molecular Properties
| Compound Name | 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate |
| PubChem CID | 141437228 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate |
| SMILES | CC=CC(=O)OCCCOC(=O)c1ccc(OC(C)OCC)cc1 |
| InChI | InChI=1S/C18H24O6/c1-4-7-17(19)22-12-6-13-23-18(20)15-8-10-16(11-9-15)24-14(3)21-5-2/h4,7-11,14H,5-6,12-13H2,1-3H3 |
| InChIKey | OXWNOKJIOASEFA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate?
The IUPAC name of 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate (CID 141437228) is 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate.
What is the SMILES notation for 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate?
The canonical SMILES for 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate is CC=CC(=O)OCCCOC(=O)c1ccc(OC(C)OCC)cc1.
What is the InChIKey of 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate?
The InChIKey is OXWNOKJIOASEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O6/c1-4-7-17(19)22-12-6-13-23-18(20)15-8-10-16(11-9-15)24-14(3)21-5-2/h4,7-11,14H,5-6,12-13H2,1-3H3.
What are the key properties of 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate?
3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate has a molecular weight of 336.38 g/mol, XLogP of 3.11, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-enoyloxypropyl 4-(1-ethoxyethoxy)benzoate is sourced from PubChem (CID 141437228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).