C12H15F2NO — CID 141437911
1-(2,2-difluoroethyl)-3,3-dimethyl-3a,4-dihydroindol-2-one (PubChem CID 141437911) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3,3-dimethyl-3a,4-dihydroindol-2-one.
| Compound Name | 1-(2,2-difluoroethyl)-3,3-dimethyl-3a,4-dihydroindol-2-one |
|---|---|
| PubChem CID | 141437911 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3,3-dimethyl-3a,4-dihydroindol-2-one |
| SMILES | CC1(C)C(=O)N(CC(F)F)C2=CC=CCC21 |
| InChI | InChI=1S/C12H15F2NO/c1-12(2)8-5-3-4-6-9(8)15(11(12)16)7-10(13)14/h3-4,6,8,10H,5,7H2,1-2H3 |
| InChIKey | VFLHVWKIALKGAP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |