About 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole
1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole (PubChem CID 141439634) has the molecular formula C18H20ClNO2S
and a molecular weight of 349.88 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole.
Molecular Properties
| Compound Name | 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole |
| PubChem CID | 141439634 |
| Molecular Formula | C18H20ClNO2S |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole |
| SMILES | CC1=CC(C)(S(=O)(=O)n2ccc3cccc(C)c32)CC=C1CCl |
| InChI | InChI=1S/C18H20ClNO2S/c1-13-5-4-6-15-8-10-20(17(13)15)23(21,22)18(3)9-7-16(12-19)14(2)11-18/h4-8,10-11H,9,12H2,1-3H3 |
| InChIKey | ZZBMJRXKLKPHMY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole?
The IUPAC name of 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole (CID 141439634) is 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole.
What is the SMILES notation for 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole?
The canonical SMILES for 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole is CC1=CC(C)(S(=O)(=O)n2ccc3cccc(C)c32)CC=C1CCl.
What is the InChIKey of 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole?
The InChIKey is ZZBMJRXKLKPHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClNO2S/c1-13-5-4-6-15-8-10-20(17(13)15)23(21,22)18(3)9-7-16(12-19)14(2)11-18/h4-8,10-11H,9,12H2,1-3H3.
What are the key properties of 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole?
1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole has a molecular weight of 349.88 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(chloromethyl)-1,3-dimethylcyclohexa-2,4-dien-1-yl]sulfonyl-7-methylindole is sourced from PubChem (CID 141439634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).