C25H30N2O4 — CID 141439637
2-[4-ethoxy-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid (PubChem CID 141439637) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[4-ethoxy-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid.
| Compound Name | 2-[4-ethoxy-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 141439637 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-[4-ethoxy-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid |
| SMILES | CCOC1CCN(Cc2c(OC)cc(C)c3[nH]ccc23)C(c2ccccc2C(=O)O)C1 |
| InChI | InChI=1S/C25H30N2O4/c1-4-31-17-10-12-27(22(14-17)18-7-5-6-8-20(18)25(28)29)15-21-19-9-11-26-24(19)16(2)13-23(21)30-3/h5-9,11,13,17,22,26H,4,10,12,14-15H2,1-3H3,(H,28,29) |
| InChIKey | ILKBLZXBYIJHIL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |