About 3-chloro-1-iodo-2,4-diisocyanatobenzene
3-chloro-1-iodo-2,4-diisocyanatobenzene (PubChem CID 141439771) has the molecular formula C8H2ClIN2O2
and a molecular weight of 320.47 g/mol. Its IUPAC name is 3-chloro-1-iodo-2,4-diisocyanatobenzene.
Molecular Properties
| Compound Name | 3-chloro-1-iodo-2,4-diisocyanatobenzene |
| PubChem CID | 141439771 |
| Molecular Formula | C8H2ClIN2O2 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 319.88 |
| IUPAC Name | 3-chloro-1-iodo-2,4-diisocyanatobenzene |
| SMILES | O=C=Nc1ccc(I)c(N=C=O)c1Cl |
| InChI | InChI=1S/C8H2ClIN2O2/c9-7-6(11-3-13)2-1-5(10)8(7)12-4-14/h1-2H |
| InChIKey | PIVQCDRBKOCRRV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1-iodo-2,4-diisocyanatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-iodo-2,4-diisocyanatobenzene?
The IUPAC name of 3-chloro-1-iodo-2,4-diisocyanatobenzene (CID 141439771) is 3-chloro-1-iodo-2,4-diisocyanatobenzene.
What is the SMILES notation for 3-chloro-1-iodo-2,4-diisocyanatobenzene?
The canonical SMILES for 3-chloro-1-iodo-2,4-diisocyanatobenzene is O=C=Nc1ccc(I)c(N=C=O)c1Cl.
What is the InChIKey of 3-chloro-1-iodo-2,4-diisocyanatobenzene?
The InChIKey is PIVQCDRBKOCRRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2ClIN2O2/c9-7-6(11-3-13)2-1-5(10)8(7)12-4-14/h1-2H.
What are the key properties of 3-chloro-1-iodo-2,4-diisocyanatobenzene?
3-chloro-1-iodo-2,4-diisocyanatobenzene has a molecular weight of 320.47 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-iodo-2,4-diisocyanatobenzene is sourced from PubChem (CID 141439771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).