About bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane
bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane (PubChem CID 141440173) has the molecular formula C12H15Cl4O2PS
and a molecular weight of 396.10 g/mol. Its IUPAC name is bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 141440173 |
| Molecular Formula | C12H15Cl4O2PS |
| Molecular Weight | 396.10 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(OC(CCl)CCl)(OC(CCl)CCl)c1ccccc1 |
| InChI | InChI=1S/C12H15Cl4O2PS/c13-6-10(7-14)17-19(20,18-11(8-15)9-16)12-4-2-1-3-5-12/h1-5,10-11H,6-9H2 |
| InChIKey | MGLMMRCFHGNOBZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.10 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane?
The IUPAC name of bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane (CID 141440173) is bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane is S=P(OC(CCl)CCl)(OC(CCl)CCl)c1ccccc1.
What is the InChIKey of bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane?
The InChIKey is MGLMMRCFHGNOBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl4O2PS/c13-6-10(7-14)17-19(20,18-11(8-15)9-16)12-4-2-1-3-5-12/h1-5,10-11H,6-9H2.
What are the key properties of bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane?
bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane has a molecular weight of 396.10 g/mol, XLogP of 4.35, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,3-dichloropropan-2-yloxy)-phenyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 141440173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).