C8H13FO — CID 141440587
4-fluoro-5,5-dimethylcyclohex-2-en-1-ol (PubChem CID 141440587) has the molecular formula C8H13FO and a molecular weight of 144.19 g/mol. Its IUPAC name is 4-fluoro-5,5-dimethylcyclohex-2-en-1-ol.
| Compound Name | 4-fluoro-5,5-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 141440587 |
| Molecular Formula | C8H13FO |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 4-fluoro-5,5-dimethylcyclohex-2-en-1-ol |
| SMILES | CC1(C)CC(O)C=CC1F |
| InChI | InChI=1S/C8H13FO/c1-8(2)5-6(10)3-4-7(8)9/h3-4,6-7,10H,5H2,1-2H3 |
| InChIKey | ZETHXHDJVMJFJW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|