About 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole
5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 141440591) has the molecular formula C18H11Cl2F3N2O
and a molecular weight of 399.20 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole |
| PubChem CID | 141440591 |
| Molecular Formula | C18H11Cl2F3N2O |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | FC(F)(F)C1(c2cc(Cl)cc(Cl)c2)CC(c2cccc3cccn23)=NO1 |
| InChI | InChI=1S/C18H11Cl2F3N2O/c19-12-7-11(8-13(20)9-12)17(18(21,22)23)10-15(24-26-17)16-5-1-3-14-4-2-6-25(14)16/h1-9H,10H2 |
| InChIKey | OVDNFKCPYYLFPT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole?
The IUPAC name of 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole (CID 141440591) is 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole.
What is the SMILES notation for 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole?
The canonical SMILES for 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole is FC(F)(F)C1(c2cc(Cl)cc(Cl)c2)CC(c2cccc3cccn23)=NO1.
What is the InChIKey of 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole?
The InChIKey is OVDNFKCPYYLFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2F3N2O/c19-12-7-11(8-13(20)9-12)17(18(21,22)23)10-15(24-26-17)16-5-1-3-14-4-2-6-25(14)16/h1-9H,10H2.
What are the key properties of 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole?
5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole has a molecular weight of 399.20 g/mol, XLogP of 5.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)-3-indolizin-5-yl-5-(trifluoromethyl)-4H-1,2-oxazole is sourced from PubChem (CID 141440591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).