C23H20O8 — CID 141440855
4,4,5-tris(2,4-dihydroxyphenyl)-5-oxopentanal (PubChem CID 141440855) has the molecular formula C23H20O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is 4,4,5-tris(2,4-dihydroxyphenyl)-5-oxopentanal.
| Compound Name | 4,4,5-tris(2,4-dihydroxyphenyl)-5-oxopentanal |
|---|---|
| PubChem CID | 141440855 |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4,4,5-tris(2,4-dihydroxyphenyl)-5-oxopentanal |
| SMILES | O=CCCC(C(=O)c1ccc(O)cc1O)(c1ccc(O)cc1O)c1ccc(O)cc1O |
| InChI | InChI=1S/C23H20O8/c24-9-1-8-23(17-6-3-14(26)11-20(17)29,18-7-4-15(27)12-21(18)30)22(31)16-5-2-13(25)10-19(16)28/h2-7,9-12,25-30H,1,8H2 |
| InChIKey | FHELYNJSVRNBOE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|