C12H15N3O4S — CID 141441123
(2S)-2-acetylsulfanyl-3-[[(E)-3-(2-methylpyrazol-3-yl)prop-2-enoyl]amino]propanoic acid (PubChem CID 141441123) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is (2S)-2-acetylsulfanyl-3-[[(E)-3-(2-methylpyrazol-3-yl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | (2S)-2-acetylsulfanyl-3-[[(E)-3-(2-methylpyrazol-3-yl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 141441123 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2S)-2-acetylsulfanyl-3-[[(E)-3-(2-methylpyrazol-3-yl)prop-2-enoyl]amino]propanoic acid |
| SMILES | CC(=O)S[C@@H](CNC(=O)/C=C/c1ccnn1C)C(=O)O |
| InChI | InChI=1S/C12H15N3O4S/c1-8(16)20-10(12(18)19)7-13-11(17)4-3-9-5-6-14-15(9)2/h3-6,10H,7H2,1-2H3,(H,13,17)(H,18,19)/b4-3+/t10-/m0/s1 |
| InChIKey | AKCUBWQKUGSJFY-FSIBCCDJSA-N |
| XLogP | 0.28 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|