About [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite
[2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite (PubChem CID 141441205) has the molecular formula C8H5F5O2S
and a molecular weight of 260.18 g/mol. Its IUPAC name is [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite.
Molecular Properties
| Compound Name | [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite |
| PubChem CID | 141441205 |
| Molecular Formula | C8H5F5O2S |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite |
| SMILES | CC(O)(F)c1c(F)c(S)c(F)c(F)c1OF |
| InChI | InChI=1S/C8H5F5O2S/c1-8(12,14)2-3(9)7(16)5(11)4(10)6(2)15-13/h14,16H,1H3 |
| InChIKey | RJTPAUZXJAOHLA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite?
The IUPAC name of [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite (CID 141441205) is [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite.
What is the SMILES notation for [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite?
The canonical SMILES for [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite is CC(O)(F)c1c(F)c(S)c(F)c(F)c1OF.
What is the InChIKey of [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite?
The InChIKey is RJTPAUZXJAOHLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F5O2S/c1-8(12,14)2-3(9)7(16)5(11)4(10)6(2)15-13/h14,16H,1H3.
What are the key properties of [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite?
[2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite has a molecular weight of 260.18 g/mol, XLogP of 2.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3,5-trifluoro-6-(1-fluoro-1-hydroxyethyl)-4-sulfanylphenyl] hypofluorite is sourced from PubChem (CID 141441205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).