About 6-amino-4,5-dichloro-2-methylpyridin-3-ol
6-amino-4,5-dichloro-2-methylpyridin-3-ol (PubChem CID 141441539) has the molecular formula C6H6Cl2N2O
and a molecular weight of 193.03 g/mol. Its IUPAC name is 6-amino-4,5-dichloro-2-methylpyridin-3-ol.
Molecular Properties
| Compound Name | 6-amino-4,5-dichloro-2-methylpyridin-3-ol |
| PubChem CID | 141441539 |
| Molecular Formula | C6H6Cl2N2O |
| Molecular Weight | 193.03 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | 6-amino-4,5-dichloro-2-methylpyridin-3-ol |
| SMILES | Cc1nc(N)c(Cl)c(Cl)c1O |
| InChI | InChI=1S/C6H6Cl2N2O/c1-2-5(11)3(7)4(8)6(9)10-2/h11H,1H3,(H2,9,10) |
| InChIKey | ZKNBFDQCVXESHS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.03 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-4,5-dichloro-2-methylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4,5-dichloro-2-methylpyridin-3-ol?
The IUPAC name of 6-amino-4,5-dichloro-2-methylpyridin-3-ol (CID 141441539) is 6-amino-4,5-dichloro-2-methylpyridin-3-ol.
What is the SMILES notation for 6-amino-4,5-dichloro-2-methylpyridin-3-ol?
The canonical SMILES for 6-amino-4,5-dichloro-2-methylpyridin-3-ol is Cc1nc(N)c(Cl)c(Cl)c1O.
What is the InChIKey of 6-amino-4,5-dichloro-2-methylpyridin-3-ol?
The InChIKey is ZKNBFDQCVXESHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2N2O/c1-2-5(11)3(7)4(8)6(9)10-2/h11H,1H3,(H2,9,10).
What are the key properties of 6-amino-4,5-dichloro-2-methylpyridin-3-ol?
6-amino-4,5-dichloro-2-methylpyridin-3-ol has a molecular weight of 193.03 g/mol, XLogP of 1.98, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4,5-dichloro-2-methylpyridin-3-ol is sourced from PubChem (CID 141441539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).