About 2H-pyrimidine-1,2-dicarboxamide
2H-pyrimidine-1,2-dicarboxamide (PubChem CID 141442073) has the molecular formula C6H8N4O2
and a molecular weight of 168.16 g/mol. Its IUPAC name is 2H-pyrimidine-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 2H-pyrimidine-1,2-dicarboxamide |
| PubChem CID | 141442073 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 2H-pyrimidine-1,2-dicarboxamide |
| SMILES | NC(=O)C1N=CC=CN1C(N)=O |
| InChI | InChI=1S/C6H8N4O2/c7-4(11)5-9-2-1-3-10(5)6(8)12/h1-3,5H,(H2,7,11)(H2,8,12) |
| InChIKey | OHOPWEZAYRBSKC-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-pyrimidine-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrimidine-1,2-dicarboxamide?
The IUPAC name of 2H-pyrimidine-1,2-dicarboxamide (CID 141442073) is 2H-pyrimidine-1,2-dicarboxamide.
What is the SMILES notation for 2H-pyrimidine-1,2-dicarboxamide?
The canonical SMILES for 2H-pyrimidine-1,2-dicarboxamide is NC(=O)C1N=CC=CN1C(N)=O.
What is the InChIKey of 2H-pyrimidine-1,2-dicarboxamide?
The InChIKey is OHOPWEZAYRBSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2/c7-4(11)5-9-2-1-3-10(5)6(8)12/h1-3,5H,(H2,7,11)(H2,8,12).
What are the key properties of 2H-pyrimidine-1,2-dicarboxamide?
2H-pyrimidine-1,2-dicarboxamide has a molecular weight of 168.16 g/mol, XLogP of -1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrimidine-1,2-dicarboxamide is sourced from PubChem (CID 141442073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).