C27H21N3O6S — CID 141442316
7-[3-[[5,6-bis(4-hydroxyphenyl)-1,2,4-triazin-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one (PubChem CID 141442316) has the molecular formula C27H21N3O6S and a molecular weight of 515.55 g/mol. Its IUPAC name is 7-[3-[[5,6-bis(4-hydroxyphenyl)-1,2,4-triazin-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one.
| Compound Name | 7-[3-[[5,6-bis(4-hydroxyphenyl)-1,2,4-triazin-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one |
|---|---|
| PubChem CID | 141442316 |
| Molecular Formula | C27H21N3O6S |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 7-[3-[[5,6-bis(4-hydroxyphenyl)-1,2,4-triazin-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one |
| SMILES | O=c1ccc2ccc(OCC(O)CSc3nnc(-c4ccc(O)cc4)c(-c4ccc(O)cc4)n3)cc2o1 |
| InChI | InChI=1S/C27H21N3O6S/c31-19-7-1-17(2-8-19)25-26(18-3-9-20(32)10-4-18)29-30-27(28-25)37-15-21(33)14-35-22-11-5-16-6-12-24(34)36-23(16)13-22/h1-13,21,31-33H,14-15H2 |
| InChIKey | WJRGBDYKTWSHNU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|