C19H24N6O3 — CID 141442333
[4-[(5-methyl-1H-pyrazol-3-yl)amino]-7-(2-morpholin-4-ylethoxy)quinazolin-2-yl]methanol (PubChem CID 141442333) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is [4-[(5-methyl-1H-pyrazol-3-yl)amino]-7-(2-morpholin-4-ylethoxy)quinazolin-2-yl]methanol.
| Compound Name | [4-[(5-methyl-1H-pyrazol-3-yl)amino]-7-(2-morpholin-4-ylethoxy)quinazolin-2-yl]methanol |
|---|---|
| PubChem CID | 141442333 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [4-[(5-methyl-1H-pyrazol-3-yl)amino]-7-(2-morpholin-4-ylethoxy)quinazolin-2-yl]methanol |
| SMILES | Cc1cc(Nc2nc(CO)nc3cc(OCCN4CCOCC4)ccc23)n[nH]1 |
| InChI | InChI=1S/C19H24N6O3/c1-13-10-17(24-23-13)21-19-15-3-2-14(11-16(15)20-18(12-26)22-19)28-9-6-25-4-7-27-8-5-25/h2-3,10-11,26H,4-9,12H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | HXZUVJHRERKBNZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 108.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |