About N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide
N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 141443116) has the molecular formula C9H12FN3O
and a molecular weight of 197.21 g/mol. Its IUPAC name is N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide |
| PubChem CID | 141443116 |
| Molecular Formula | C9H12FN3O |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(F)c1C(=O)NC1CC1 |
| InChI | InChI=1S/C9H12FN3O/c1-5-7(8(10)13(2)12-5)9(14)11-6-3-4-6/h6H,3-4H2,1-2H3,(H,11,14) |
| InChIKey | PQXBIVDSJZZZSM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide?
The IUPAC name of N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide (CID 141443116) is N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide.
What is the SMILES notation for N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide?
The canonical SMILES for N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide is Cc1nn(C)c(F)c1C(=O)NC1CC1.
What is the InChIKey of N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide?
The InChIKey is PQXBIVDSJZZZSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN3O/c1-5-7(8(10)13(2)12-5)9(14)11-6-3-4-6/h6H,3-4H2,1-2H3,(H,11,14).
What are the key properties of N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide?
N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide has a molecular weight of 197.21 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-5-fluoro-1,3-dimethylpyrazole-4-carboxamide is sourced from PubChem (CID 141443116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).