C11H11F3IN3O — CID 141443212
1-[5-iodo-4-(trifluoromethyl)-2-pyridinyl]-3,4-dimethylimidazolidin-2-one (PubChem CID 141443212) has the molecular formula C11H11F3IN3O and a molecular weight of 385.13 g/mol. Its IUPAC name is 1-[5-iodo-4-(trifluoromethyl)-2-pyridinyl]-3,4-dimethylimidazolidin-2-one.
| Compound Name | 1-[5-iodo-4-(trifluoromethyl)-2-pyridinyl]-3,4-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 141443212 |
| Molecular Formula | C11H11F3IN3O |
| Molecular Weight | 385.13 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 1-[5-iodo-4-(trifluoromethyl)-2-pyridinyl]-3,4-dimethylimidazolidin-2-one |
| SMILES | CC1CN(c2cc(C(F)(F)F)c(I)cn2)C(=O)N1C |
| InChI | InChI=1S/C11H11F3IN3O/c1-6-5-18(10(19)17(6)2)9-3-7(11(12,13)14)8(15)4-16-9/h3-4,6H,5H2,1-2H3 |
| InChIKey | VLXZBTQVBKWMCV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.13 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|