C9H12S3 — CID 141443331
4,5,6-trimethylbenzene-1,2,3-trithiol (PubChem CID 141443331) has the molecular formula C9H12S3 and a molecular weight of 216.40 g/mol. Its IUPAC name is 4,5,6-trimethylbenzene-1,2,3-trithiol.
| Compound Name | 4,5,6-trimethylbenzene-1,2,3-trithiol |
|---|---|
| PubChem CID | 141443331 |
| Molecular Formula | C9H12S3 |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 4,5,6-trimethylbenzene-1,2,3-trithiol |
| SMILES | Cc1c(C)c(S)c(S)c(S)c1C |
| InChI | InChI=1S/C9H12S3/c1-4-5(2)7(10)9(12)8(11)6(4)3/h10-12H,1-3H3 |
| InChIKey | GNODKVDWDHIIQR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|