C13H20S — CID 141443372
2-[(4,4-dimethylcyclohexyl)methyl]thiophene (PubChem CID 141443372) has the molecular formula C13H20S and a molecular weight of 208.37 g/mol. Its IUPAC name is 2-[(4,4-dimethylcyclohexyl)methyl]thiophene.
| Compound Name | 2-[(4,4-dimethylcyclohexyl)methyl]thiophene |
|---|---|
| PubChem CID | 141443372 |
| Molecular Formula | C13H20S |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-[(4,4-dimethylcyclohexyl)methyl]thiophene |
| SMILES | CC1(C)CCC(Cc2cccs2)CC1 |
| InChI | InChI=1S/C13H20S/c1-13(2)7-5-11(6-8-13)10-12-4-3-9-14-12/h3-4,9,11H,5-8,10H2,1-2H3 |
| InChIKey | KWOPRDISLYMKGE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |