C13H8ClF3N2O3 — CID 141443443
5-[2-(4-chlorophenyl)-3,3,3-trifluoroprop-1-enyl]-3-methyl-4-nitro-1,2-oxazole (PubChem CID 141443443) has the molecular formula C13H8ClF3N2O3 and a molecular weight of 332.67 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-3,3,3-trifluoroprop-1-enyl]-3-methyl-4-nitro-1,2-oxazole.
| Compound Name | 5-[2-(4-chlorophenyl)-3,3,3-trifluoroprop-1-enyl]-3-methyl-4-nitro-1,2-oxazole |
|---|---|
| PubChem CID | 141443443 |
| Molecular Formula | C13H8ClF3N2O3 |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-3,3,3-trifluoroprop-1-enyl]-3-methyl-4-nitro-1,2-oxazole |
| SMILES | Cc1noc(C=C(c2ccc(Cl)cc2)C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8ClF3N2O3/c1-7-12(19(20)21)11(22-18-7)6-10(13(15,16)17)8-2-4-9(14)5-3-8/h2-6H,1H3 |
| InChIKey | ILKWERFOQAHNHC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|