C14H27BN2O3 — CID 141443811
4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxamide (PubChem CID 141443811) has the molecular formula C14H27BN2O3 and a molecular weight of 282.19 g/mol. Its IUPAC name is 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxamide.
| Compound Name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 141443811 |
| Molecular Formula | C14H27BN2O3 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]pyrrolidine-3-carboxamide |
| SMILES | CC1(C)OB(CCCC2CNCC2C(N)=O)OC1(C)C |
| InChI | InChI=1S/C14H27BN2O3/c1-13(2)14(3,4)20-15(19-13)7-5-6-10-8-17-9-11(10)12(16)18/h10-11,17H,5-9H2,1-4H3,(H2,16,18) |
| InChIKey | MCBGDQDAVYEBBG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|