About (Z)-4-amino-1,3-diphenylbut-2-en-1-one
(Z)-4-amino-1,3-diphenylbut-2-en-1-one (PubChem CID 141444019) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is (Z)-4-amino-1,3-diphenylbut-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-4-amino-1,3-diphenylbut-2-en-1-one |
| PubChem CID | 141444019 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (Z)-4-amino-1,3-diphenylbut-2-en-1-one |
| SMILES | NC/C(=C\C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c17-12-15(13-7-3-1-4-8-13)11-16(18)14-9-5-2-6-10-14/h1-11H,12,17H2/b15-11+ |
| InChIKey | HAHTYLGIMUMNJY-RVDMUPIBSA-N |
| XLogP | 2.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-amino-1,3-diphenylbut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-amino-1,3-diphenylbut-2-en-1-one?
The IUPAC name of (Z)-4-amino-1,3-diphenylbut-2-en-1-one (CID 141444019) is (Z)-4-amino-1,3-diphenylbut-2-en-1-one.
What is the SMILES notation for (Z)-4-amino-1,3-diphenylbut-2-en-1-one?
The canonical SMILES for (Z)-4-amino-1,3-diphenylbut-2-en-1-one is NC/C(=C\C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-4-amino-1,3-diphenylbut-2-en-1-one?
The InChIKey is HAHTYLGIMUMNJY-RVDMUPIBSA-N. The full InChI is InChI=1S/C16H15NO/c17-12-15(13-7-3-1-4-8-13)11-16(18)14-9-5-2-6-10-14/h1-11H,12,17H2/b15-11+.
What are the key properties of (Z)-4-amino-1,3-diphenylbut-2-en-1-one?
(Z)-4-amino-1,3-diphenylbut-2-en-1-one has a molecular weight of 237.30 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-amino-1,3-diphenylbut-2-en-1-one is sourced from PubChem (CID 141444019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).