About propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate
propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate (PubChem CID 141444225) has the molecular formula C12H13NO4S
and a molecular weight of 267.31 g/mol. Its IUPAC name is propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate |
| PubChem CID | 141444225 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate |
| SMILES | CC(C)OC(=O)C(C#N)C1C=CC=CC1=S(=O)=O |
| InChI | InChI=1S/C12H13NO4S/c1-8(2)17-12(14)10(7-13)9-5-3-4-6-11(9)18(15)16/h3-6,8-10H,1-2H3 |
| InChIKey | KLUFYIXSAUWIEN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate?
The IUPAC name of propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate (CID 141444225) is propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate.
What is the SMILES notation for propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate?
The canonical SMILES for propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate is CC(C)OC(=O)C(C#N)C1C=CC=CC1=S(=O)=O.
What is the InChIKey of propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate?
The InChIKey is KLUFYIXSAUWIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4S/c1-8(2)17-12(14)10(7-13)9-5-3-4-6-11(9)18(15)16/h3-6,8-10H,1-2H3.
What are the key properties of propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate?
propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate has a molecular weight of 267.31 g/mol, XLogP of 0.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-cyano-2-(6-sulfonylcyclohexa-2,4-dien-1-yl)acetate is sourced from PubChem (CID 141444225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).