C12H15N3O2 — CID 141444428
(7R,8aS)-7-(6-amino-3-pyridinyl)-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one (PubChem CID 141444428) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is (7R,8aS)-7-(6-amino-3-pyridinyl)-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one.
| Compound Name | (7R,8aS)-7-(6-amino-3-pyridinyl)-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 141444428 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (7R,8aS)-7-(6-amino-3-pyridinyl)-6,7,8,8a-tetrahydro-1H-pyrrolo[2,1-c][1,4]oxazin-4-one |
| SMILES | Nc1ccc([C@H]2C[C@H]3COCC(=O)N3C2)cn1 |
| InChI | InChI=1S/C12H15N3O2/c13-11-2-1-8(4-14-11)9-3-10-6-17-7-12(16)15(10)5-9/h1-2,4,9-10H,3,5-7H2,(H2,13,14)/t9-,10-/m0/s1 |
| InChIKey | KUIIUQAAOFTOHD-UWVGGRQHSA-N |
| XLogP | 0.38 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |