C19H17FN4O2 — CID 141444513
4-(3-aminopyrazin-2-yl)-2-fluoro-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide (PubChem CID 141444513) has the molecular formula C19H17FN4O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is 4-(3-aminopyrazin-2-yl)-2-fluoro-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide.
| Compound Name | 4-(3-aminopyrazin-2-yl)-2-fluoro-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 141444513 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-(3-aminopyrazin-2-yl)-2-fluoro-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide |
| SMILES | Nc1nccnc1-c1ccc(C(=O)N[C@H](CO)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C19H17FN4O2/c20-15-10-13(17-18(21)23-9-8-22-17)6-7-14(15)19(26)24-16(11-25)12-4-2-1-3-5-12/h1-10,16,25H,11H2,(H2,21,23)(H,24,26)/t16-/m1/s1 |
| InChIKey | PPPGGWVEFPCFMP-MRXNPFEDSA-N |
| XLogP | 2.33 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |