6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid

C11H9NO3 — CID 141444661

IUPAC6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid
SMILESO=C(O)c1coc2cc(C3CC3)cnc12
InChIInChI=1S/C11H9NO3/c13-11(14)8-5-15-9-3-7(6-1-2-6)4-12-10(8)9/h3-6H,1-2H2,(H,13,14)
InChIKeyUIBSQPJXZRJPCS-UHFFFAOYSA-N
MW203.20 g/mol
LogP2.40
Rot. Bonds2

About 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid

6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid (PubChem CID 141444661) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid
PubChem CID141444661
Molecular FormulaC11H9NO3
Molecular Weight203.20 g/mol
Exact Mass203.06
IUPAC Name6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid
SMILESO=C(O)c1coc2cc(C3CC3)cnc12
InChIInChI=1S/C11H9NO3/c13-11(14)8-5-15-9-3-7(6-1-2-6)4-12-10(8)9/h3-6H,1-2H2,(H,13,14)
InChIKeyUIBSQPJXZRJPCS-UHFFFAOYSA-N
XLogP2.40
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 52.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid?
The IUPAC name of 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid (CID 141444661) is 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid.
What is the SMILES notation for 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid?
The canonical SMILES for 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid is O=C(O)c1coc2cc(C3CC3)cnc12.
What is the InChIKey of 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid?
The InChIKey is UIBSQPJXZRJPCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c13-11(14)8-5-15-9-3-7(6-1-2-6)4-12-10(8)9/h3-6H,1-2H2,(H,13,14).
What are the key properties of 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid?
6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid has a molecular weight of 203.20 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropylfuro[3,2-b]pyridine-3-carboxylic acid is sourced from PubChem (CID 141444661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).