C10H10N2O2 — CID 141445688
methyl 1,2-dihydro-1,6-naphthyridine-7-carboxylate (PubChem CID 141445688) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is methyl 1,2-dihydro-1,6-naphthyridine-7-carboxylate.
| Compound Name | methyl 1,2-dihydro-1,6-naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 141445688 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | methyl 1,2-dihydro-1,6-naphthyridine-7-carboxylate |
| SMILES | COC(=O)c1cc2c(cn1)C=CCN2 |
| InChI | InChI=1S/C10H10N2O2/c1-14-10(13)9-5-8-7(6-12-9)3-2-4-11-8/h2-3,5-6,11H,4H2,1H3 |
| InChIKey | ODFDOJDSCQGWEI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |