About 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide
3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide (PubChem CID 141446060) has the molecular formula C22H17N3O2
and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide.
Molecular Properties
| Compound Name | 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide |
| PubChem CID | 141446060 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide |
| SMILES | NC(=O)C=Cc1cc(-c2ccccc2)ccc1-c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C22H17N3O2/c23-21(26)11-8-16-12-15(14-4-2-1-3-5-14)6-9-18(16)17-7-10-19-20(13-17)25-22(27)24-19/h1-13H,(H2,23,26)(H2,24,25,27) |
| InChIKey | ZZVAPOLHFRIKKB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide?
The IUPAC name of 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide (CID 141446060) is 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide.
What is the SMILES notation for 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide?
The canonical SMILES for 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide is NC(=O)C=Cc1cc(-c2ccccc2)ccc1-c1ccc2[nH]c(=O)[nH]c2c1.
What is the InChIKey of 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide?
The InChIKey is ZZVAPOLHFRIKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O2/c23-21(26)11-8-16-12-15(14-4-2-1-3-5-14)6-9-18(16)17-7-10-19-20(13-17)25-22(27)24-19/h1-13H,(H2,23,26)(H2,24,25,27).
What are the key properties of 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide?
3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide has a molecular weight of 355.40 g/mol, XLogP of 3.69, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)-5-phenylphenyl]prop-2-enamide is sourced from PubChem (CID 141446060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).