C21H23F7OSi — CID 141446097
tert-butyl-dimethyl-[4-[1,1,2,2-tetrafluoro-2-[4-(trifluoromethyl)phenyl]ethyl]phenoxy]silane (PubChem CID 141446097) has the molecular formula C21H23F7OSi and a molecular weight of 452.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-[1,1,2,2-tetrafluoro-2-[4-(trifluoromethyl)phenyl]ethyl]phenoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4-[1,1,2,2-tetrafluoro-2-[4-(trifluoromethyl)phenyl]ethyl]phenoxy]silane |
|---|---|
| PubChem CID | 141446097 |
| Molecular Formula | C21H23F7OSi |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | tert-butyl-dimethyl-[4-[1,1,2,2-tetrafluoro-2-[4-(trifluoromethyl)phenyl]ethyl]phenoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C(F)(F)C(F)(F)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H23F7OSi/c1-18(2,3)30(4,5)29-17-12-10-15(11-13-17)20(24,25)19(22,23)14-6-8-16(9-7-14)21(26,27)28/h6-13H,1-5H3 |
| InChIKey | HJYSJYHWFUBGLO-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|