C25H27N5 — CID 141446127
6-[[5-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]-2H-pyridin-1-yl]methyl]isoquinolin-1-amine (PubChem CID 141446127) has the molecular formula C25H27N5 and a molecular weight of 397.53 g/mol. Its IUPAC name is 6-[[5-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]-2H-pyridin-1-yl]methyl]isoquinolin-1-amine.
| Compound Name | 6-[[5-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]-2H-pyridin-1-yl]methyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 141446127 |
| Molecular Formula | C25H27N5 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 6-[[5-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]-2H-pyridin-1-yl]methyl]isoquinolin-1-amine |
| SMILES | Nc1nccc2cc(CN3C=C(Cc4ccc(N5CCCC5)nc4)C=CC3)ccc12 |
| InChI | InChI=1S/C25H27N5/c26-25-23-7-5-21(15-22(23)9-10-27-25)18-29-11-3-4-20(17-29)14-19-6-8-24(28-16-19)30-12-1-2-13-30/h3-10,15-17H,1-2,11-14,18H2,(H2,26,27) |
| InChIKey | NUXQXUBGPOMIIY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |