C22H16ClF3N2 — CID 141446139
4-(2-chloro-4-fluorophenyl)-5-[4-(2-cyclopropylethynyl)-2,6-difluorophenyl]-1,3-dimethylpyrazole (PubChem CID 141446139) has the molecular formula C22H16ClF3N2 and a molecular weight of 400.83 g/mol. Its IUPAC name is 4-(2-chloro-4-fluorophenyl)-5-[4-(2-cyclopropylethynyl)-2,6-difluorophenyl]-1,3-dimethylpyrazole.
| Compound Name | 4-(2-chloro-4-fluorophenyl)-5-[4-(2-cyclopropylethynyl)-2,6-difluorophenyl]-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 141446139 |
| Molecular Formula | C22H16ClF3N2 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-(2-chloro-4-fluorophenyl)-5-[4-(2-cyclopropylethynyl)-2,6-difluorophenyl]-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(-c2c(F)cc(C#CC3CC3)cc2F)c1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H16ClF3N2/c1-12-20(16-8-7-15(24)11-17(16)23)22(28(2)27-12)21-18(25)9-14(10-19(21)26)6-5-13-3-4-13/h7-11,13H,3-4H2,1-2H3 |
| InChIKey | STCJLMBRLUFHHY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|