C7H14F4O2Si — CID 141446755
2,2,3,3-tetrafluoro-4-trimethylsilyloxybutan-1-ol (PubChem CID 141446755) has the molecular formula C7H14F4O2Si and a molecular weight of 234.26 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-trimethylsilyloxybutan-1-ol.
| Compound Name | 2,2,3,3-tetrafluoro-4-trimethylsilyloxybutan-1-ol |
|---|---|
| PubChem CID | 141446755 |
| Molecular Formula | C7H14F4O2Si |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-trimethylsilyloxybutan-1-ol |
| SMILES | C[Si](C)(C)OCC(F)(F)C(F)(F)CO |
| InChI | InChI=1S/C7H14F4O2Si/c1-14(2,3)13-5-7(10,11)6(8,9)4-12/h12H,4-5H2,1-3H3 |
| InChIKey | YJUXCZWTDNLYHQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|