About [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol
[2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol (PubChem CID 141447034) has the molecular formula C15H28O3
and a molecular weight of 256.39 g/mol. Its IUPAC name is [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol |
| PubChem CID | 141447034 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol |
| SMILES | CCCC(CC(C)CC(C)C)C1OC=C(CO)O1 |
| InChI | InChI=1S/C15H28O3/c1-5-6-13(8-12(4)7-11(2)3)15-17-10-14(9-16)18-15/h10-13,15-16H,5-9H2,1-4H3 |
| InChIKey | BKCBVVJRUYBELH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol?
The IUPAC name of [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol (CID 141447034) is [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol.
What is the SMILES notation for [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol?
The canonical SMILES for [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol is CCCC(CC(C)CC(C)C)C1OC=C(CO)O1.
What is the InChIKey of [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol?
The InChIKey is BKCBVVJRUYBELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3/c1-5-6-13(8-12(4)7-11(2)3)15-17-10-14(9-16)18-15/h10-13,15-16H,5-9H2,1-4H3.
What are the key properties of [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol?
[2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol has a molecular weight of 256.39 g/mol, XLogP of 3.68, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6,8-dimethylnonan-4-yl)-1,3-dioxol-4-yl]methanol is sourced from PubChem (CID 141447034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).